CAS 50670-50-3 appears in our catalog under these names: 4-Cyano-4'-methylbiphenyl, 98%, 4–Cyano–4'–methylbiphenyl, 4-Cyano-4'-methylbiphenyl, 4′-Methyl[1,1′-biphenyl]-4-carbonitrile, 97%, 97%, 4-Cyano-4'-methylbiphenyl, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 50g, 250mg.
4-(4-methylphenyl)benzonitrile (CAS 50670-50-3) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 4-(4-methylphenyl)benzonitrile. InChIKey: QIBWMVSMTSYUSK-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-(4-methylphenyl)benzonitrile |
| InChIKey | QIBWMVSMTSYUSK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)