CAS 3128-85-6 appears in our catalog under these names: Diphenylmethyl isocyanide, 97%, (Isocyanomethylene)dibenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
[isocyano(phenyl)methyl]benzene (CAS 3128-85-6) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: [isocyano(phenyl)methyl]benzene. InChIKey: REKQCRSUOJRCDV-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | [isocyano(phenyl)methyl]benzene |
| InChIKey | REKQCRSUOJRCDV-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)