CAS 1863-21-4 appears in our catalog under these names: 7-Phenyl-1h-indole, 95%, 7-Phenyl-1H-indole, 97%, 97%, 7-Phenyl-1H-indole, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
7-phenyl-1H-indole (CAS 1863-21-4) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 7-phenyl-1H-indole. InChIKey: PIEDFMITVNDHRR-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 7-phenyl-1H-indole |
| InChIKey | PIEDFMITVNDHRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2NC=C3 |
Computed by PubChem (NCBI)