CAS 51624-44-3 appears in our catalog under these names: 3–(Phenylethynyl)aniline, 3-(phenylethynyl)aniline, 3-(Phenylethynyl)aniline, 95%, 3-(Phenylethynyl)aniline, 99%, 99%, 3-(Phenylethynyl)aniline, 99%+(GC-MS),RG. Offered by: GLPBio, Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
3-(2-phenylethynyl)aniline (CAS 51624-44-3) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 3-(2-phenylethynyl)aniline. InChIKey: BOKCJGOOHNNDCL-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 3-(2-phenylethynyl)aniline |
| InChIKey | BOKCJGOOHNNDCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)