4-Cyanobenzenesulfonyl chloride, 98%
cas: 49584-26-1 — see every product listed under this CAS number, including other names
4-Cyanobenzenesulfonyl chloride, 98% (CAS 49584-26-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A831044-1g |
| cas | 49584-26-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1071.25 Pln | |
| Ambeed | 500g | 4575.62 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 214.39 Pln | |
| BLDpharm | 10g | 242.16 Pln | |
| BLDpharm | 25g | 375.45 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-cyanobenzenesulfonyl chloride (CAS 49584-26-1) is a chemical compound with the molecular formula C7H4ClNO2S and a molecular weight of 201.63 g/mol. IUPAC name: 4-cyanobenzenesulfonyl chloride. InChIKey: DBMFYTQPPBBKHI-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO2S |
|---|---|
| Molecular weight | 201.63 g/mol |
| IUPAC name | 4-cyanobenzenesulfonyl chloride |
| InChIKey | DBMFYTQPPBBKHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Cyanobenzenesulfonyl chloride, 4-cyanobenzene-1-sulfonyl chloride, Benzenesulfonyl chloride, 4-cyano-, 4-cyanobenzenesulfonylchloride, 4-Cyano benzenesulfonyl Chloride, P-CYANOBENZENESULPHONYL CHLORIDE, 4-cyano-benzenesulfonyl chloride, 4-cyanobenzene sulfonyl chloride, 4-Cyanobenzenesulfonyl chloride, 97%, 4-(chlorosulfonyl)benzenecarbonitrile