cas: 27634-89-5 — see every product listed under this CAS number, including other names
4-Cyclohexylbenzaldehyde 97% (CAS 27634-89-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A563752-100mg |
| cas | 27634-89-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 1772.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A563752 |
4-cyclohexylbenzaldehyde (CAS 27634-89-5) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 4-cyclohexylbenzaldehyde. InChIKey: KUHNCPCUPOPMDY-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 4-cyclohexylbenzaldehyde |
| InChIKey | KUHNCPCUPOPMDY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)