cas: 27634-89-5 — see every product listed under this CAS number, including other names
4-Cyclohexylbenzaldehyde, 97%, 97% (CAS 27634-89-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BG5Y-100mg |
| cas | 27634-89-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 500mg | 885.20 Pln | |
| Chemat | 1g | 1336.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-cyclohexylbenzaldehyde (CAS 27634-89-5) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 4-cyclohexylbenzaldehyde. InChIKey: KUHNCPCUPOPMDY-UHFFFAOYSA-N.
| Molecular formula | C13H16O |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | 4-cyclohexylbenzaldehyde |
| InChIKey | KUHNCPCUPOPMDY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)