4-Cyclopropoxy-3-methoxybenzoic acid, 95%
cas: 1243355-05-6 — see every product listed under this CAS number, including other names
4-Cyclopropoxy-3-methoxybenzoic acid, 95% (CAS 1243355-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1582338-250mg |
| cas | 1243355-05-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2689.94 Pln | |
| Ambeed | 1g | 6861.81 Pln | |
| BLDpharm | 100mg | 1674.99 Pln | |
| BLDpharm | 250mg | 2635.76 Pln | |
| BLDpharm | 1g | 6728.77 Pln | |
| Chemat | 100mg | 1346.00 Pln | |
| Chemat | 250mg | 2114.00 Pln | |
| Chemat | 1g | 5392.40 Pln | |
| Fluorochem | 1g | 9827.81 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-cyclopropyloxy-3-methoxybenzoic acid (CAS 1243355-05-6) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 4-cyclopropyloxy-3-methoxybenzoic acid. InChIKey: WOJZLUXBYOFRKZ-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-cyclopropyloxy-3-methoxybenzoic acid |
| InChIKey | WOJZLUXBYOFRKZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)OC2CC2 |
Computed by PubChem (NCBI)