cas: 1451391-67-5 — see every product listed under this CAS number, including other names
4-Ethoxy-2,3-dimethylphenylboronic acid, ≥95%, ≥95% (CAS 1451391-67-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KXNM-1g |
| cas | 1451391-67-5 |
| size | 1g |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1494.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(4-ethoxy-2,3-dimethylphenyl)boronic acid (CAS 1451391-67-5) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (4-ethoxy-2,3-dimethylphenyl)boronic acid. InChIKey: UXAVIFNGKPGZPI-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (4-ethoxy-2,3-dimethylphenyl)boronic acid |
| InChIKey | UXAVIFNGKPGZPI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC)C)C)(O)O |
Computed by PubChem (NCBI)