cas: 26131-61-3 — see every product listed under this CAS number, including other names
4-Ethyl-5-phenyl-4H-1,2,4-triazole-3-thiol, 95+%, 95+% (CAS 26131-61-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113RTC-50mg |
| cas | 26131-61-3 |
| size | 50mg |
| availability | 80g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 362.00 Pln | |
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 500mg | 1062.80 Pln | |
| Chemat | 1g | 1360.40 Pln | |
| Chemat | 5g | 3496.40 Pln | |
| Chemat | 10g | 5642.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
4-ethyl-3-phenyl-1H-1,2,4-triazole-5-thione (CAS 26131-61-3) is a chemical compound with the molecular formula C10H11N3S and a molecular weight of 205.28 g/mol. IUPAC name: 4-ethyl-3-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: TWQMMYPNEWSRLM-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 4-ethyl-3-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | TWQMMYPNEWSRLM-UHFFFAOYSA-N |
| SMILES | CCN1C(=NNC1=S)C2=CC=CC=C2 |
Computed by PubChem (NCBI)