CAS 383130-54-9 appears in our catalog under these names: 5-(3,5-Dimethylphenyl)-1,3,4-thiadiazol-2-amine, 95%, 5-(3,5-Dimethylphenyl)-1,3,4-thiadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 2,5g.
5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-amine (CAS 383130-54-9) is a chemical compound with the molecular formula C10H11N3S and a molecular weight of 205.28 g/mol. IUPAC name: 5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: NMUYFXIGDRWUJS-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 5-(3,5-dimethylphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | NMUYFXIGDRWUJS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=NN=C(S2)N)C |
Computed by PubChem (NCBI)