CAS 66297-59-4 appears in our catalog under these names: 4-(2,4-Dimethylphenyl)-4h-1,2,4-triazole-3-thiol, 95%, 4-(2,4-Dimethylphenyl)-4H-1,2,4-triazole-3-thiol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-(2,4-dimethylphenyl)-1H-1,2,4-triazole-5-thione (CAS 66297-59-4) is a chemical compound with the molecular formula C10H11N3S and a molecular weight of 205.28 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: OFSNDWPHJFKJEV-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | OFSNDWPHJFKJEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C=NNC2=S)C |
Computed by PubChem (NCBI)