CAS 4994-88-1 appears in our catalog under these names: 5,6,7,8-Tetrahydro-benzo[4,5]thieno[2,3-d]pyrimidin-4-ylamine, 95%, 5,6,7,8-Tetrahydro-benzo[4,5]thieno[2,3-d]pyrimidin-4-ylamine, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (CAS 4994-88-1) is a chemical compound with the molecular formula C10H11N3S and a molecular weight of 205.28 g/mol. IUPAC name: 5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine. InChIKey: QXPQVUQBEBHHQP-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| InChIKey | QXPQVUQBEBHHQP-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N=CN=C3S2)N |
Computed by PubChem (NCBI)