CAS 919738-05-9 is the registry number for 2-[2-(3-Pyridinyl)-1,3-thiazol-4-yl]ethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethanamine (CAS 919738-05-9) is a chemical compound with the molecular formula C10H11N3S and a molecular weight of 205.28 g/mol. IUPAC name: 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethanamine. InChIKey: PZKIIHTUOGOFKQ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethanamine |
| InChIKey | PZKIIHTUOGOFKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC(=CS2)CCN |
Computed by PubChem (NCBI)