cas: 141179-72-8 — see every product listed under this CAS number, including other names
4-Fluoro-2-(trifluoromethyl)benzoic acid, 98%, 98% (CAS 141179-72-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112G1N-5g |
| cas | 141179-72-8 |
| size | 5g |
| availability | 849g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 294.80 Pln | |
| Chemat | 500g | 1233.60 Pln | |
| Chemat | 50g | 179.60 Pln | |
| Chemat | 250g | 635.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-fluoro-2-(trifluoromethyl)benzoic acid (CAS 141179-72-8) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 4-fluoro-2-(trifluoromethyl)benzoic acid. InChIKey: JUHPDXOIGLHXTC-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 4-fluoro-2-(trifluoromethyl)benzoic acid |
| InChIKey | JUHPDXOIGLHXTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)