cas: 2377611-30-6 — see every product listed under this CAS number, including other names
4-Fluoro-3-(N-methylamino)phenylboronic acid pinacol ester, 97%, 97% (CAS 2377611-30-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JWFY-50mg |
| cas | 2377611-30-6 |
| size | 50mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 755.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2377611-30-6) is a chemical compound with the molecular formula C13H19BFNO2 and a molecular weight of 251.11 g/mol. IUPAC name: 2-fluoro-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: NZGRWWGMNLRFKR-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | 2-fluoro-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | NZGRWWGMNLRFKR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)NC |
Computed by PubChem (NCBI)