Products 2638502-43-7
CAS 2638502-43-7 is the registry number for 3-Fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2638502-43-7) is a chemical compound with the molecular formula C13H19BFNO2 and a molecular weight of 251.11 g/mol. IUPAC name: 3-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: VAXLSMJHODAQGY-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | 3-fluoro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | VAXLSMJHODAQGY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2C)F)N |
Computed by PubChem (NCBI)