CAS 2096329-84-7 is the registry number for 2-Aminomethyl-4-fluorophenylboronic acid, pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
[5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (CAS 2096329-84-7) is a chemical compound with the molecular formula C13H19BFNO2 and a molecular weight of 251.11 g/mol. IUPAC name: [5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine. InChIKey: SNXZTLFBOPVDKD-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | [5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| InChIKey | SNXZTLFBOPVDKD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)CN |
Computed by PubChem (NCBI)