CAS 939968-50-0 is the registry number for 2-Fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 939968-50-0) is a chemical compound with the molecular formula C13H19BFNO2 and a molecular weight of 251.11 g/mol. IUPAC name: 2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: UGNGQDFZULGKEL-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | 2-fluoro-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | UGNGQDFZULGKEL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C)N)F |
Computed by PubChem (NCBI)