CAS 2377609-12-4 appears in our catalog under these names: 2-Amino-5-fluoro-4-methylphenylboronic acid, pinacol ester, 97%, 4-Fluoro-5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-fluoro-5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2377609-12-4) is a chemical compound with the molecular formula C13H19BFNO2 and a molecular weight of 251.11 g/mol. IUPAC name: 4-fluoro-5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: FWFCTINWKHIBSP-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | 4-fluoro-5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | FWFCTINWKHIBSP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2N)C)F |
Computed by PubChem (NCBI)