cas: 872459-87-5 — see every product listed under this CAS number, including other names
4-Fluoro-3-methoxycarbonylphenylboronic acid pinacol ester, 97%, 97% (CAS 872459-87-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C1PL-10g |
| cas | 872459-87-5 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 750.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 500mg | 131.60 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 443.60 Pln | |
| Chemat | 25g | 1456.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 872459-87-5) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: methyl 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: PILMRJXFJLIVFU-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | methyl 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | PILMRJXFJLIVFU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)C(=O)OC |
Computed by PubChem (NCBI)