4-Fluoro-3-nitrophenol 98%
cas: 2105-96-6 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitrophenol 98% (CAS 2105-96-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A165013-250mg |
| cas | 2105-96-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 565.06 Pln | |
| Ambeed | 100g | 2055.81 Pln | |
| Ambeed | 500g | 8007.69 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A165013 |
4-fluoro-3-nitrophenol (CAS 2105-96-6) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 4-fluoro-3-nitrophenol. InChIKey: JSRMPTJZAJUPGZ-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 4-fluoro-3-nitrophenol |
| InChIKey | JSRMPTJZAJUPGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)