Products 2369-10-0
CAS 2369-10-0 appears in our catalog under these names: 3-Fluoro-5-nitrophenol, 98%, 3-Fluoro-5-nitrophenol 98%, 3-Fluoro-5-nitrophenol, 97%, 97%, 3-Fluoro-5-nitro-phenol, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
3-fluoro-5-nitrophenol (CAS 2369-10-0) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 3-fluoro-5-nitrophenol. InChIKey: YOMAXLMXNGCFRA-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 3-fluoro-5-nitrophenol |
| InChIKey | YOMAXLMXNGCFRA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)