4-Fluoro-3-nitrophenol, 95%
cas: 2105-96-6 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitrophenol, 95% (CAS 2105-96-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F317803-1G |
| cas | 2105-96-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 10g | 258.26 Pln | |
| Fluorochem | 25g | 549.82 Pln | |
| Fluorochem | 100g | 1955.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-fluoro-3-nitrophenol (CAS 2105-96-6) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 4-fluoro-3-nitrophenol. InChIKey: JSRMPTJZAJUPGZ-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 4-fluoro-3-nitrophenol |
| InChIKey | JSRMPTJZAJUPGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)