CAS 2105-96-6 appears in our catalog under these names: 4-Fluoro-3-nitrophenol, 97%, 4-Fluoro-3-nitrophenol, 4-Fluoro-3-nitrophenol 98%, 4-Fluoro-3-nitrophenol, 98%, 98%, 4-Fluoro-3-nitrophenol, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 50g, 250mg, 500g.
4-fluoro-3-nitrophenol (CAS 2105-96-6) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 4-fluoro-3-nitrophenol. InChIKey: JSRMPTJZAJUPGZ-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 4-fluoro-3-nitrophenol |
| InChIKey | JSRMPTJZAJUPGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)