Products 1227576-95-5

CAS 1227576-95-5 appears in our catalog under these names: 2-fluoro-3-hydroxyisonicotinic acid, 95%+, 95%+, 2-Fluoro-3-hydroxyisonicotinic acid, 95%, 2-Fluoro-3-hydroxyisonicotinic acid. Offered by: Chemat, Combi-blocks, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-fluoro-3-hydroxypyridine-4-carboxylic acid (CAS 1227576-95-5) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 2-fluoro-3-hydroxypyridine-4-carboxylic acid. InChIKey: ILTRDDUNTDIMDR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4FNO3
Molecular weight157.10 g/mol
IUPAC name2-fluoro-3-hydroxypyridine-4-carboxylic acid
InChIKeyILTRDDUNTDIMDR-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1C(=O)O)O)F

Computed by PubChem (NCBI)