CAS 403-19-0 appears in our catalog under these names: 2–Fluoro–4–nitrophenol, 2-Fluoro-4-nitrophenol, 98+% , 2-Fluoro-4-nitrophenol, 2-Fluoro-4-nitrophenol, >98.0%(GC)(T), 2-Fluoro-4-nitrophenol 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 500g, 5g, 25g, 250g, 50g, 10g, 1000g.
2-fluoro-4-nitrophenol (CAS 403-19-0) is a chemical compound with the molecular formula C6H4FNO3 and a molecular weight of 157.10 g/mol. IUPAC name: 2-fluoro-4-nitrophenol. InChIKey: ORPHLVJBJOCHBR-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO3 |
|---|---|
| Molecular weight | 157.10 g/mol |
| IUPAC name | 2-fluoro-4-nitrophenol |
| InChIKey | ORPHLVJBJOCHBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)O |
Computed by PubChem (NCBI)