cas: 450-39-5 — see every product listed under this CAS number, including other names
4-Fluoro-4'-methoxy-1,1'-biphenyl 98% (CAS 450-39-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1241968-100mg |
| cas | 450-39-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1171.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1241968 |
1-fluoro-4-(4-methoxyphenyl)benzene (CAS 450-39-5) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: 1-fluoro-4-(4-methoxyphenyl)benzene. InChIKey: HPHJIGXCDCZLTP-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-fluoro-4-(4-methoxyphenyl)benzene |
| InChIKey | HPHJIGXCDCZLTP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)