4-Fluoro-5-methoxy-2-nitrobenzoic acid, 98%
cas: 864293-50-5 — see every product listed under this CAS number, including other names
4-Fluoro-5-methoxy-2-nitrobenzoic acid, 98% (CAS 864293-50-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 2.5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch119GCO-100mg |
| cas | 864293-50-5 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 530.00 Pln | |
| Fluorochem | 250mg | 102.06 Pln | |
| Fluorochem | 500mg | 133.30 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 2.5g | 372.80 Pln | |
| Fluorochem | 5g | 555.03 Pln | |
| Fluorochem | 10g | 961.14 Pln | |
| Fluorochem | 25g | 2304.41 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-fluoro-5-methoxy-2-nitrobenzoic acid (CAS 864293-50-5) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 4-fluoro-5-methoxy-2-nitrobenzoic acid. InChIKey: MGLFJUZFMICSSW-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 4-fluoro-5-methoxy-2-nitrobenzoic acid |
| InChIKey | MGLFJUZFMICSSW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])F |
Computed by PubChem (NCBI)