cas: 320-97-8 — see every product listed under this CAS number, including other names
4-Fluorophthalic acid, 98%, 98% (CAS 320-97-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149T8-1g |
| cas | 320-97-8 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 218.00 Pln | |
| Chemat | 100g | 688.40 Pln | |
| Chemat | 500g | 2750.40 Pln | |
| Chemat | 1kg | 5008.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-fluorophthalic acid (CAS 320-97-8) is a chemical compound with the molecular formula C8H5FO4 and a molecular weight of 184.12 g/mol. IUPAC name: 4-fluorophthalic acid. InChIKey: OMCXTFVBNCFZMY-UHFFFAOYSA-N.
| Molecular formula | C8H5FO4 |
|---|---|
| Molecular weight | 184.12 g/mol |
| IUPAC name | 4-fluorophthalic acid |
| InChIKey | OMCXTFVBNCFZMY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)