Products 2138193-88-9
CAS 2138193-88-9 appears in our catalog under these names: 6-fluoro-2-formyl-3-hydroxybenzoic acid, 6-Fluoro-2-formyl-3-hydroxybenzoic Acid, ≥95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 1g.
6-fluoro-2-formyl-3-hydroxybenzoic acid (CAS 2138193-88-9) is a chemical compound with the molecular formula C8H5FO4 and a molecular weight of 184.12 g/mol. IUPAC name: 6-fluoro-2-formyl-3-hydroxybenzoic acid. InChIKey: FLOZRVYJZHJLBZ-UHFFFAOYSA-N.
| Molecular formula | C8H5FO4 |
|---|---|
| Molecular weight | 184.12 g/mol |
| IUPAC name | 6-fluoro-2-formyl-3-hydroxybenzoic acid |
| InChIKey | FLOZRVYJZHJLBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)C=O)C(=O)O)F |
Computed by PubChem (NCBI)