4-Formyl-1,2-phenylene diacetate, 98%
cas: 67727-64-4 — see every product listed under this CAS number, including other names
4-Formyl-1,2-phenylene diacetate, 98% (CAS 67727-64-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A102763-1g |
| cas | 67727-64-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 693.00 Pln | |
| Ambeed | 100g | 2022.44 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 25g | 506.00 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 292.14 Pln | |
| BLDpharm | 25g | 741.99 Pln | |
| BLDpharm | 100g | 2174.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2-acetyloxy-4-formylphenyl) acetate (CAS 67727-64-4) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: (2-acetyloxy-4-formylphenyl) acetate. InChIKey: WYHMNJKAVNPOOR-UHFFFAOYSA-N.
| Molecular formula | C11H10O5 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | (2-acetyloxy-4-formylphenyl) acetate |
| InChIKey | WYHMNJKAVNPOOR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=O)OC(=O)C |
Computed by PubChem (NCBI)