CAS 41514-66-3 appears in our catalog under these names: (2E)-3-(7-Methoxy-1,3-benzodioxol-5-yl)-2-propenoic acid, 95%, 3,4-Methylenedioxy-5-methoxycinnamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 2g.
(E)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid (CAS 41514-66-3) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: (E)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid. InChIKey: TWUVAPFWYKZLOT-NSCUHMNNSA-N.
| Molecular formula | C11H10O5 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | (E)-3-(7-methoxy-1,3-benzodioxol-5-yl)prop-2-enoic acid |
| InChIKey | TWUVAPFWYKZLOT-NSCUHMNNSA-N |
| SMILES | COC1=CC(=CC2=C1OCO2)/C=C/C(=O)O |
Computed by PubChem (NCBI)