CAS 67727-64-4 appears in our catalog under these names: 4-Formyl-1,2-phenylene diacetate 98%, 4-Formyl-1,2-Phenylene Diacetate, 98%, 98%, 3,4-Diacetoxybenzaldehyde, 98%, 3,4–Diacetoxybenzaldehyde, 3,4-Diacetoxybenzaldehyde, >98.0%(GC). Offered by: Ambeed, Chemat, Combi-blocks, GLPBio, TCI. Available pack sizes: 1g, 5g, 25g, 100g.
(2-acetyloxy-4-formylphenyl) acetate (CAS 67727-64-4) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: (2-acetyloxy-4-formylphenyl) acetate. InChIKey: WYHMNJKAVNPOOR-UHFFFAOYSA-N.
| Molecular formula | C11H10O5 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | (2-acetyloxy-4-formylphenyl) acetate |
| InChIKey | WYHMNJKAVNPOOR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C=O)OC(=O)C |
Computed by PubChem (NCBI)