Products 21405-61-8

CAS 21405-61-8 is the registry number for 2-(4-Methoxybenzylidene)malonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(4-methoxyphenyl)methylidene]propanedioic acid (CAS 21405-61-8) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methylidene]propanedioic acid. InChIKey: QYXHQRJWUMDWGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O5
Molecular weight222.19 g/mol
IUPAC name2-[(4-methoxyphenyl)methylidene]propanedioic acid
InChIKeyQYXHQRJWUMDWGJ-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C=C(C(=O)O)C(=O)O

Computed by PubChem (NCBI)