CAS 2555-38-6 appears in our catalog under these names: 4-hydroxy-5,7-dimethoxy-2H-chromen-2-one, 98%, 4–hydroxy–5,7–diMethoxy–2H–1–benzopyrane–2–one. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 200mg.
4-hydroxy-5,7-dimethoxychromen-2-one (CAS 2555-38-6) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: 4-hydroxy-5,7-dimethoxychromen-2-one. InChIKey: BSUBLNPXIPCSFW-UHFFFAOYSA-N.
| Molecular formula | C11H10O5 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | 4-hydroxy-5,7-dimethoxychromen-2-one |
| InChIKey | BSUBLNPXIPCSFW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=CC(=O)O2)O)C(=C1)OC |
Computed by PubChem (NCBI)