cas: 94930-47-9 — see every product listed under this CAS number, including other names
4-Formyl-2,5-dimethoxybenzoic acid 98% (CAS 94930-47-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1597622-100mg |
| cas | 94930-47-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 4024.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1597622 |
4-formyl-2,5-dimethoxybenzoic acid (CAS 94930-47-9) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 4-formyl-2,5-dimethoxybenzoic acid. InChIKey: LMINRADLQBBPIF-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 4-formyl-2,5-dimethoxybenzoic acid |
| InChIKey | LMINRADLQBBPIF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C=O)OC)C(=O)O |
Computed by PubChem (NCBI)