cas: 33259-21-1 — see every product listed under this CAS number, including other names
4-Hydroxy-2,6-dimethylnicotinic acid 95% (CAS 33259-21-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A292093-100mg |
| cas | 33259-21-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 3379.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A292093 |
2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid (CAS 33259-21-1) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid. InChIKey: SXBRRFLLEOHXIO-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,6-dimethyl-4-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | SXBRRFLLEOHXIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(N1)C)C(=O)O |
Computed by PubChem (NCBI)