cas: 1093203-96-3 — see every product listed under this CAS number, including other names
4-Hydroxy-2-nitrobenzonitrile 95% (CAS 1093203-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A267549-100mg |
| cas | 1093203-96-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 509.44 Pln | |
| Ambeed | 250mg | 815.38 Pln | |
| Ambeed | 1g | 2061.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A267549 |
4-hydroxy-2-nitrobenzonitrile (CAS 1093203-96-3) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 4-hydroxy-2-nitrobenzonitrile. InChIKey: LQRAMXMRWNDIMB-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 4-hydroxy-2-nitrobenzonitrile |
| InChIKey | LQRAMXMRWNDIMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)