cas: 15785-54-3 — see every product listed under this CAS number, including other names
4-Hydroxy-3-methoxy-5-nitrobenzoic acid 98% (CAS 15785-54-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122358-250mg |
| cas | 15785-54-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 481.62 Pln | |
| Ambeed | 100g | 1432.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A122358 |
4-hydroxy-3-methoxy-5-nitrobenzoic acid (CAS 15785-54-3) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 4-hydroxy-3-methoxy-5-nitrobenzoic acid. InChIKey: AEDVAGWYAKIOIM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | 4-hydroxy-3-methoxy-5-nitrobenzoic acid |
| InChIKey | AEDVAGWYAKIOIM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)