Products 2353107-88-5
CAS 2353107-88-5 is the registry number for 3-Hydroxy-2-nitrophenoxyacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-hydroxy-2-nitrophenoxy)acetic acid (CAS 2353107-88-5) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 2-(3-hydroxy-2-nitrophenoxy)acetic acid. InChIKey: JBBHLIICEVTBPD-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | 2-(3-hydroxy-2-nitrophenoxy)acetic acid |
| InChIKey | JBBHLIICEVTBPD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OCC(=O)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)