cas: 15785-54-3 — see every product listed under this CAS number, including other names
4-Hydroxy-3-methoxy-5-nitrobenzoic acid, 98%, 98% (CAS 15785-54-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112PRC-250mg |
| cas | 15785-54-3 |
| size | 250mg |
| availability | 4500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 100g | 611.60 Pln | |
| Chemat | 500g | 2160.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-hydroxy-3-methoxy-5-nitrobenzoic acid (CAS 15785-54-3) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 4-hydroxy-3-methoxy-5-nitrobenzoic acid. InChIKey: AEDVAGWYAKIOIM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | 4-hydroxy-3-methoxy-5-nitrobenzoic acid |
| InChIKey | AEDVAGWYAKIOIM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)