CAS 169616-13-1 is the registry number for 3,6-Dihydro-2H-[1,4]dioxino[2,3-c]pyrrole-5,7-dicarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole-5,7-dicarboxylic acid (CAS 169616-13-1) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole-5,7-dicarboxylic acid. InChIKey: MUKLTUYFKHGLDJ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | 3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole-5,7-dicarboxylic acid |
| InChIKey | MUKLTUYFKHGLDJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(NC(=C2O1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)