Products 169616-13-1

CAS 169616-13-1 is the registry number for 3,6-Dihydro-2H-[1,4]dioxino[2,3-c]pyrrole-5,7-dicarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole-5,7-dicarboxylic acid (CAS 169616-13-1) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole-5,7-dicarboxylic acid. InChIKey: MUKLTUYFKHGLDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7NO6
Molecular weight213.14 g/mol
IUPAC name3,6-dihydro-2H-[1,4]dioxino[2,3-c]pyrrole-5,7-dicarboxylic acid
InChIKeyMUKLTUYFKHGLDJ-UHFFFAOYSA-N
SMILESC1COC2=C(NC(=C2O1)C(=O)O)C(=O)O

Computed by PubChem (NCBI)