cas: 15785-54-3 — see every product listed under this CAS number, including other names
4-Hydroxy-3-methoxy-5-nitrobenzoic acid, 99.94% (CAS 15785-54-3) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 25 g, 1 g, 100 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-79012-10 g |
| cas | 15785-54-3 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 454.37 Pln | |
| MedChemExpress | 5 g | 333.62 Pln | |
| MedChemExpress | 25 g | 719.08 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 100 g | 1559.64 Pln | |
| MedChemExpress | 50 g | 1081.31 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.94% |
4-hydroxy-3-methoxy-5-nitrobenzoic acid (CAS 15785-54-3) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 4-hydroxy-3-methoxy-5-nitrobenzoic acid. InChIKey: AEDVAGWYAKIOIM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | 4-hydroxy-3-methoxy-5-nitrobenzoic acid |
| InChIKey | AEDVAGWYAKIOIM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)