CAS 182281-01-2 appears in our catalog under these names: 4-Hydroxyphenylboronic acid-THP-ether/ 95+%, 4-(Tetrahydro-2H-pyran-2-yloxy)phenylboronic Acid (contains varying amounts of Anhydride), (4-((Tetrahydro-2H-pyran-2-yl)oxy)phenyl)boronic acid 97%, (4-((Tetrahydro-2H-pyran-2-yl)oxy)phenyl)boronic acid, 98%, 98%, 4-Hydroxyphenylboronic acid-THP-ether, 96%. Offered by: Chemat, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 10g, 100g, 500g.
[4-(oxan-2-yloxy)phenyl]boronic acid (CAS 182281-01-2) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: [4-(oxan-2-yloxy)phenyl]boronic acid. InChIKey: DMGMCZRNMYQQQB-UHFFFAOYSA-N.
| Molecular formula | C11H15BO4 |
|---|---|
| Molecular weight | 222.05 g/mol |
| IUPAC name | [4-(oxan-2-yloxy)phenyl]boronic acid |
| InChIKey | DMGMCZRNMYQQQB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2CCCCO2)(O)O |
Computed by PubChem (NCBI)