Products 182281-01-2

CAS 182281-01-2 appears in our catalog under these names: 4-Hydroxyphenylboronic acid-THP-ether/ 95+%, 4-(Tetrahydro-2H-pyran-2-yloxy)phenylboronic Acid (contains varying amounts of Anhydride), (4-((Tetrahydro-2H-pyran-2-yl)oxy)phenyl)boronic acid 97%, (4-((Tetrahydro-2H-pyran-2-yl)oxy)phenyl)boronic acid, 98%, 98%, 4-Hydroxyphenylboronic acid-THP-ether, 96%. Offered by: Chemat, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 10g, 100g, 500g.

Structural formula: {0} (CAS {1})

[4-(oxan-2-yloxy)phenyl]boronic acid (CAS 182281-01-2) is a chemical compound with the molecular formula C11H15BO4 and a molecular weight of 222.05 g/mol. IUPAC name: [4-(oxan-2-yloxy)phenyl]boronic acid. InChIKey: DMGMCZRNMYQQQB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15BO4
Molecular weight222.05 g/mol
IUPAC name[4-(oxan-2-yloxy)phenyl]boronic acid
InChIKeyDMGMCZRNMYQQQB-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)OC2CCCCO2)(O)O

Computed by PubChem (NCBI)