4-Iodo-3-(trifluoromethoxy)aniline, 95%
cas: 851045-63-1 — see every product listed under this CAS number, including other names
4-Iodo-3-(trifluoromethoxy)aniline, 95% (CAS 851045-63-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A474460-250mg |
| cas | 851045-63-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 1249.25 Pln | |
| BLDpharm | 100mg | 347.68 Pln | |
| BLDpharm | 250mg | 536.50 Pln | |
| BLDpharm | 1g | 1341.77 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1264.40 Pln | |
| Fluorochem | 100mg | 570.65 Pln | |
| Fluorochem | 250mg | 919.49 Pln | |
| Fluorochem | 1g | 2340.86 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-iodo-3-(trifluoromethoxy)aniline (CAS 851045-63-1) is a chemical compound with the molecular formula C7H5F3INO and a molecular weight of 303.02 g/mol. IUPAC name: 4-iodo-3-(trifluoromethoxy)aniline. InChIKey: VDVMGAPDTJTWDH-UHFFFAOYSA-N.
| Molecular formula | C7H5F3INO |
|---|---|
| Molecular weight | 303.02 g/mol |
| IUPAC name | 4-iodo-3-(trifluoromethoxy)aniline |
| InChIKey | VDVMGAPDTJTWDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)OC(F)(F)F)I |
Computed by PubChem (NCBI)