CAS 503184-34-7 is the registry number for 3-Iodo-6-methoxy-2-(trifluoromethyl)pyridine. Offered by: TRC. Available pack sizes: 500mg.
3-iodo-6-methoxy-2-(trifluoromethyl)pyridine (CAS 503184-34-7) is a chemical compound with the molecular formula C7H5F3INO and a molecular weight of 303.02 g/mol. IUPAC name: 3-iodo-6-methoxy-2-(trifluoromethyl)pyridine. InChIKey: OALNBVZKAAUOCT-UHFFFAOYSA-N.
| Molecular formula | C7H5F3INO |
|---|---|
| Molecular weight | 303.02 g/mol |
| IUPAC name | 3-iodo-6-methoxy-2-(trifluoromethyl)pyridine |
| InChIKey | OALNBVZKAAUOCT-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)I)C(F)(F)F |
Computed by PubChem (NCBI)