CAS 940908-06-5 is the registry number for 2-Iodo-5-(trifluoromethoxy)aniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-iodo-5-(trifluoromethoxy)aniline (CAS 940908-06-5) is a chemical compound with the molecular formula C7H5F3INO and a molecular weight of 303.02 g/mol. IUPAC name: 2-iodo-5-(trifluoromethoxy)aniline. InChIKey: SCFZBZGJXHIKEP-UHFFFAOYSA-N.
| Molecular formula | C7H5F3INO |
|---|---|
| Molecular weight | 303.02 g/mol |
| IUPAC name | 2-iodo-5-(trifluoromethoxy)aniline |
| InChIKey | SCFZBZGJXHIKEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)N)I |
Computed by PubChem (NCBI)