CAS 887707-27-9 is the registry number for 5-Iodo-2-methoxy-3-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-iodo-2-methoxy-3-(trifluoromethyl)pyridine (CAS 887707-27-9) is a chemical compound with the molecular formula C7H5F3INO and a molecular weight of 303.02 g/mol. IUPAC name: 5-iodo-2-methoxy-3-(trifluoromethyl)pyridine. InChIKey: YSWCSGKWJKJWRB-UHFFFAOYSA-N.
| Molecular formula | C7H5F3INO |
|---|---|
| Molecular weight | 303.02 g/mol |
| IUPAC name | 5-iodo-2-methoxy-3-(trifluoromethyl)pyridine |
| InChIKey | YSWCSGKWJKJWRB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=N1)I)C(F)(F)F |
Computed by PubChem (NCBI)